CAS 2350703-67-0 is the registry number for ((1S,3S)-3-(4-Bromophenyl)-2,2-difluorocyclopropyl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,3S)-3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol (CAS 2350703-67-0) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: [(1S,3S)-3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol. InChIKey: VDHSLLLIRILCKQ-RKDXNWHRSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [(1S,3S)-3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol |
| InChIKey | VDHSLLLIRILCKQ-RKDXNWHRSA-N |
| SMILES | C1=CC(=CC=C1[C@@H]2[C@H](C2(F)F)CO)Br |
Computed by PubChem (NCBI)