CAS 1343874-92-9 appears in our catalog under these names: (4-Bromo-2,5-difluorophenyl)(cyclopropyl)methanol, 95%, (4-Bromo-2,5-difluorophenyl)(cyclopropyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(4-bromo-2,5-difluorophenyl)-cyclopropylmethanol (CAS 1343874-92-9) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: (4-bromo-2,5-difluorophenyl)-cyclopropylmethanol. InChIKey: BJYMYGWDBCENSB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenyl)-cyclopropylmethanol |
| InChIKey | BJYMYGWDBCENSB-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=C(C=C2F)Br)F)O |
Computed by PubChem (NCBI)