CAS 2504202-98-4 is the registry number for 1-Bromo-4-(cyclopropylmethoxy)-2,3-difluorobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-bromo-4-(cyclopropylmethoxy)-2,3-difluorobenzene (CAS 2504202-98-4) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: 1-bromo-4-(cyclopropylmethoxy)-2,3-difluorobenzene. InChIKey: ZRAXENVMKRQWPP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 1-bromo-4-(cyclopropylmethoxy)-2,3-difluorobenzene |
| InChIKey | ZRAXENVMKRQWPP-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C(=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)