CAS 862457-93-0 is the registry number for 1-Bromo-1,1-difluoro-4-phenylbutan-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-1,1-difluoro-4-phenylbutan-2-one (CAS 862457-93-0) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: 1-bromo-1,1-difluoro-4-phenylbutan-2-one. InChIKey: RTPKWCNOYXXOTD-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 1-bromo-1,1-difluoro-4-phenylbutan-2-one |
| InChIKey | RTPKWCNOYXXOTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)C(F)(F)Br |
Computed by PubChem (NCBI)