Products 2771025-15-9
CAS 2771025-15-9 is the registry number for (1-(3-Bromophenyl)-2,2-difluorocyclopropyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[1-(3-bromophenyl)-2,2-difluorocyclopropyl]methanol (CAS 2771025-15-9) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: [1-(3-bromophenyl)-2,2-difluorocyclopropyl]methanol. InChIKey: OLRHOAPEOLOOAC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [1-(3-bromophenyl)-2,2-difluorocyclopropyl]methanol |
| InChIKey | OLRHOAPEOLOOAC-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(CO)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)