CAS 60357-78-0 is the registry number for 7-Nitro-1,2-benzisoxazol-3(2H)-one, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-nitro-1,2-benzoxazol-3-one (CAS 60357-78-0) is a chemical compound with the molecular formula C7H4N2O4 and a molecular weight of 180.12 g/mol. IUPAC name: 7-nitro-1,2-benzoxazol-3-one. InChIKey: USIDBICZJTWOCD-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O4 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 7-nitro-1,2-benzoxazol-3-one |
| InChIKey | USIDBICZJTWOCD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])ONC2=O |
Computed by PubChem (NCBI)