Products 1251110-16-3
CAS 1251110-16-3 is the registry number for 4-Cyano-2-methylbenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
4-cyano-2-methylbenzenesulfonyl chloride (CAS 1251110-16-3) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 4-cyano-2-methylbenzenesulfonyl chloride. InChIKey: VLUSOMHSAVNNLL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 4-cyano-2-methylbenzenesulfonyl chloride |
| InChIKey | VLUSOMHSAVNNLL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)