CAS 1251922-87-8 appears in our catalog under these names: Methyl 2-(3,4-dichlorophenyl)-2-(methylamino)acetate hydrochloride, 95%, Methyl 2-(3,4-dichlorophenyl)-2-(methylamino)acetate hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
Methyl 2-(3,4-dichlorophenyl)-2-(methylamino)acetate;hydrochloride (CAS 1251922-87-8) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: methyl 2-(3,4-dichlorophenyl)-2-(methylamino)acetate;hydrochloride. InChIKey: QUQZEOMRZJNFQL-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | methyl 2-(3,4-dichlorophenyl)-2-(methylamino)acetate;hydrochloride |
| InChIKey | QUQZEOMRZJNFQL-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC(=C(C=C1)Cl)Cl)C(=O)OC.Cl |
Computed by PubChem (NCBI)