CAS 1251923-47-3 appears in our catalog under these names: 4-Amino-4-(3,4-dichlorophenyl)butanoic acid hydrochloride, 95%, 4-Amino-4-(3,4-dichlorophenyl)butanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride (CAS 1251923-47-3) is a chemical compound with the molecular formula C10H12Cl3NO2 and a molecular weight of 284.6 g/mol. IUPAC name: 4-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride. InChIKey: UBGCSEQWVMTFOL-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl3NO2 |
|---|---|
| Molecular weight | 284.6 g/mol |
| IUPAC name | 4-amino-4-(3,4-dichlorophenyl)butanoic acid;hydrochloride |
| InChIKey | UBGCSEQWVMTFOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(CCC(=O)O)N)Cl)Cl.Cl |
Computed by PubChem (NCBI)