Products 1256345-67-1
CAS 1256345-67-1 appears in our catalog under these names: (4-Cyano-2-methoxyphenyl)boronic acid, 95%, (4-Cyano-2-methoxyphenyl)boronic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 50g.
(4-cyano-2-methoxyphenyl)boronic acid (CAS 1256345-67-1) is a chemical compound with the molecular formula C8H8BNO3 and a molecular weight of 176.97 g/mol. IUPAC name: (4-cyano-2-methoxyphenyl)boronic acid. InChIKey: CCUBWDNQHCIXNF-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO3 |
|---|---|
| Molecular weight | 176.97 g/mol |
| IUPAC name | (4-cyano-2-methoxyphenyl)boronic acid |
| InChIKey | CCUBWDNQHCIXNF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C#N)OC)(O)O |
Computed by PubChem (NCBI)