CAS 1256355-81-3 is the registry number for 2-(2,3-Difluorophenylmethoxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[2-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid (CAS 1256355-81-3) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [2-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid. InChIKey: ALZGXXJMVCAYEJ-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [2-[(2,3-difluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | ALZGXXJMVCAYEJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=C(C(=CC=C2)F)F)(O)O |
Computed by PubChem (NCBI)