Products 125950-99-4
CAS 125950-99-4 is the registry number for tert-Butyl (2E)-3-(4-chlorophenyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 125950-99-4) is a chemical compound with the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: BMIKRPUHJWEHQJ-RMKNXTFCSA-N.
| Molecular formula | C13H15ClO2 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | BMIKRPUHJWEHQJ-RMKNXTFCSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)