Products 1261522-11-5
CAS 1261522-11-5 appears in our catalog under these names: 2-(2-Chloro-6-cyanophenyl)acetic acid, 95%, 2-(2-Chloro-6-cyanophenyl)acetic acid, 98+%, 2-(2-chloro-6-cyanophenyl)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 500mg, 100mg, 1g, 0,5g, 50mg.
2-(2-chloro-6-cyanophenyl)acetic acid (CAS 1261522-11-5) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 2-(2-chloro-6-cyanophenyl)acetic acid. InChIKey: SKPHIYPSRLDDPU-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 2-(2-chloro-6-cyanophenyl)acetic acid |
| InChIKey | SKPHIYPSRLDDPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)O)C#N |
Computed by PubChem (NCBI)