Products 1261682-98-7
CAS 1261682-98-7 appears in our catalog under these names: 2-Cyano-4-methylbenzenesulfonyl chloride, 98%, 2-Cyano-4-methylbenzene-1-sulfonyl chloride, 2-Cyano-4-methylbenzene-1-sulfonyl chloride, 97%, 97%, 2-Cyano-4-methylbenzene-1-sulfonyl chloride, 98%. Offered by: Fluorochem, Biosynth, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-cyano-4-methylbenzenesulfonyl chloride (CAS 1261682-98-7) is a chemical compound with the molecular formula C8H6ClNO2S and a molecular weight of 215.66 g/mol. IUPAC name: 2-cyano-4-methylbenzenesulfonyl chloride. InChIKey: QBINCWCUKSGTNZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2S |
|---|---|
| Molecular weight | 215.66 g/mol |
| IUPAC name | 2-cyano-4-methylbenzenesulfonyl chloride |
| InChIKey | QBINCWCUKSGTNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)