Products 1266541-83-6

CAS 1266541-83-6 is the registry number for 4-[(2-Ethoxyphenyl)(methylsulfonyl)amino]butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-(2-ethoxy-N-methylsulfonylanilino)butanoic acid (CAS 1266541-83-6) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: 4-(2-ethoxy-N-methylsulfonylanilino)butanoic acid. InChIKey: BUXJZWJJESXMIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO5S
Molecular weight301.36 g/mol
IUPAC name4-(2-ethoxy-N-methylsulfonylanilino)butanoic acid
InChIKeyBUXJZWJJESXMIZ-UHFFFAOYSA-N
SMILESCCOC1=CC=CC=C1N(CCCC(=O)O)S(=O)(=O)C

Computed by PubChem (NCBI)