Products 20845-17-4
CAS 20845-17-4 appears in our catalog under these names: (S)–Allyl 2–aminopropanoate 4–methylbenzenesulfonate, (S)-Allyl 2-aminopropanoate 4-methylbenzenesulfonate, 95%, (S)-Allyl 2-aminopropanoate 4-methylbenzenesulfonate, 95%, 95%, H-Ala-allyl ester p-tosylate, 95%. Offered by: GLPBio, AmBeed, Chemat, Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-aminopropanoate (CAS 20845-17-4) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-aminopropanoate. InChIKey: PXNUQOZOYKVNEI-ZSCHJXSPSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-aminopropanoate |
| InChIKey | PXNUQOZOYKVNEI-ZSCHJXSPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C[C@@H](C(=O)OCC=C)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-Allyl 2-aminopropanoate 4-methylbenzenesulfonate, H-Ala-allyl ester p-tosylate, L-Alanine, 2-propenyl ester, 4-methylbenzenesulfonate (9CI), 4-methylbenzenesulfonic acid;prop-2-enyl (2S)-2-aminopropanoate, 4-methylbenzene-1-sulfonic acid; prop-2-en-1-yl (2S)-2-aminopropanoate, H-Ala-allyl ester ? p-tosylate, (S)-Allyl2-aminopropanoate4-methylbenzenesulfonate, allyl (2S)-2-aminopropanoate;4-methylbenzenesulfonic acid