Products 35785-20-7
CAS 35785-20-7 appears in our catalog under these names: 4-Aminobenzyl 1-Thio-Beta-D-galactopryranoside, >95% (HPLC), 4-Aminobenzyl b-D-thiogalactopyranoside. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 50mg, 100mg.
(2S,3R,4S,5R,6R)-2-[(4-aminophenyl)methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 35785-20-7) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: (2S,3R,4S,5R,6R)-2-[(4-aminophenyl)methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: VNOKYKUWHBAQKG-SJHCENCUSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-2-[(4-aminophenyl)methylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | VNOKYKUWHBAQKG-SJHCENCUSA-N |
| SMILES | C1=CC(=CC=C1CS[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)N |
Computed by PubChem (NCBI)