Products 28242-02-6
CAS 28242-02-6 is the registry number for Hydroxy Probenecid. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-hydroxypropyl(propyl)sulfamoyl]benzoic acid (CAS 28242-02-6) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: 4-[2-hydroxypropyl(propyl)sulfamoyl]benzoic acid. InChIKey: LSENJUHYDIWQAU-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | 4-[2-hydroxypropyl(propyl)sulfamoyl]benzoic acid |
| InChIKey | LSENJUHYDIWQAU-UHFFFAOYSA-N |
| SMILES | CCCN(CC(C)O)S(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)