Products 870300-77-9
CAS 870300-77-9 is the registry number for Hydroxy 1-(Phenylsulfonyl)ethylcarbamic acid 1,1-Dimethylethyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
Tert-butyl N-[1-(benzenesulfonyl)ethyl]-N-hydroxycarbamate (CAS 870300-77-9) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: tert-butyl N-[1-(benzenesulfonyl)ethyl]-N-hydroxycarbamate. InChIKey: GQMKJAWOLAXTKP-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | tert-butyl N-[1-(benzenesulfonyl)ethyl]-N-hydroxycarbamate |
| InChIKey | GQMKJAWOLAXTKP-UHFFFAOYSA-N |
| SMILES | CC(N(C(=O)OC(C)(C)C)O)S(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)