CAS 497860-54-5 is the registry number for Ethyl n-(4-methoxyphenyl)-n-(methylsulfonyl)alaninate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-(4-methoxy-N-methylsulfonylanilino)propanoate (CAS 497860-54-5) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: ethyl 2-(4-methoxy-N-methylsulfonylanilino)propanoate. InChIKey: HUQNIFGNTHZHOL-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | ethyl 2-(4-methoxy-N-methylsulfonylanilino)propanoate |
| InChIKey | HUQNIFGNTHZHOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)N(C1=CC=C(C=C1)OC)S(=O)(=O)C |
Computed by PubChem (NCBI)