CAS 149490-60-8 appears in our catalog under these names: Tirofiban Impurity 82, Tirofiban Impurity A, Debutylpiperidine Tirofiban, >95% (HPLC), (S)–2–(Butylsulfonamido)–3–(4–hydroxyphenyl)propanoic acid, (S)-2-(Butylsulfonamido)-3-(4-Hydroxyphenyl)Propanoic Acid, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 1g, 2,5g, 100g, 10g, 25g, 5g.
(2S)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 149490-60-8) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: (2S)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: VCKJOKXXEIQENI-LBPRGKRZSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | (2S)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | VCKJOKXXEIQENI-LBPRGKRZSA-N |
| SMILES | CCCCS(=O)(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)