CAS 25370-96-1 is the registry number for tert-Butyl N-methyl-N-((4-methylbenzenesulfonyl)oxy)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate (CAS 25370-96-1) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: [methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate. InChIKey: ZQCMKORYYUNZPB-UHFFFAOYSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | [methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino] 4-methylbenzenesulfonate |
| InChIKey | ZQCMKORYYUNZPB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)ON(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)