CAS 1346918-32-8 appears in our catalog under these names: Tirofiban Impurity 47, (Butylsulfonyl)-D-tyrosine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 1346918-32-8) is a chemical compound with the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. IUPAC name: (2R)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: VCKJOKXXEIQENI-GFCCVEGCSA-N.
| Molecular formula | C13H19NO5S |
|---|---|
| Molecular weight | 301.36 g/mol |
| IUPAC name | (2R)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | VCKJOKXXEIQENI-GFCCVEGCSA-N |
| SMILES | CCCCS(=O)(=O)N[C@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)