CAS 1269461-96-2 appears in our catalog under these names: 5-phenoxy-1,3-thiazol-2-amine, 5-Phenoxy-1,3-thiazol-2-amine, 95%, 5-Phenoxy-1,3-thiazol-2-amine, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Chemat. Available pack sizes: 1g, 100mg, 250mg.
5-phenoxy-1,3-thiazol-2-amine (CAS 1269461-96-2) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 5-phenoxy-1,3-thiazol-2-amine. InChIKey: LBLQZXVZGDUZIN-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 5-phenoxy-1,3-thiazol-2-amine |
| InChIKey | LBLQZXVZGDUZIN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CN=C(S2)N |
Computed by PubChem (NCBI)