Products 1270001-72-3
CAS 1270001-72-3 is the registry number for 4,9-Dimethoxycanthin-6-one. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
4,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one (CAS 1270001-72-3) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 4,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one. InChIKey: WBMNWMYQWQQWHM-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 4,13-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| InChIKey | WBMNWMYQWQQWHM-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3=C4N2C(=O)C=C(C4=NC=C3)OC |
Computed by PubChem (NCBI)