CAS 127369-30-6 appears in our catalog under these names: Cefadroxil Impurity 19, Methyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate Hydrochloride, >95% (HPLC), Methyl (2S)-Amino(4-hydroxyphenyl)ethanoate Hydrochloride, (S)–Methyl 2–amino–2–(4–hydroxyphenyl)acetate hydrochloride, (S)-Methyl 2-amino-2-(4-hydroxyphenyl)acetate HCl ee. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 1g, 2,5g, 250mg, 25mg, 10g, 25g, 5g.
Methyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride (CAS 127369-30-6) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride. InChIKey: UYCKVJUNDXPDJH-QRPNPIFTSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl (2S)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | UYCKVJUNDXPDJH-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](C1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)