CAS 57591-61-4 appears in our catalog under these names: D-4-hydroxyphenylglycine methyl ester HCl, (R)-AMINO-(4-HYDROXYPHENYL)ACETIC ACID &, D-4-Hydroxyphenylglycine methyl ester hydrochloride, 95%, H-D-Phg(4-OH)-OMe HCl 95%, (R)-Amino-(4-hydroxyphenyl)acetic Acid Methyl Ester Hydrochloride, >95% (HPLC). Offered by: Biosynth, Sigma-Aldrich, Fluorochem, Ambeed, TRC. Available pack sizes: 1kg, 2kg, 5G, 1g, 25g, 100g, 500g, 10g.
Methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride (CAS 57591-61-4) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride. InChIKey: UYCKVJUNDXPDJH-DDWIOCJRSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(4-hydroxyphenyl)acetate;hydrochloride |
| InChIKey | UYCKVJUNDXPDJH-DDWIOCJRSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)