CAS 1279854-47-5 is the registry number for 6,8-Dichloro-1,7-naphthyridine, 97+%. Offered by: Chemat Brand. Available pack sizes: on request.
6,8-dichloro-1,7-naphthyridine (CAS 1279854-47-5) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 6,8-dichloro-1,7-naphthyridine. InChIKey: RSHMATSURUMCIM-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 6,8-dichloro-1,7-naphthyridine |
| InChIKey | RSHMATSURUMCIM-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=NC(=C2N=C1)Cl)Cl |
Computed by PubChem (NCBI)