CAS 129700-35-2 is the registry number for 1,1,1-Trifluoro-5-(p-tolyl)pentane-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1-trifluoro-5-(4-methylphenyl)pentane-2,4-dione (CAS 129700-35-2) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1,1,1-trifluoro-5-(4-methylphenyl)pentane-2,4-dione. InChIKey: FOTCJBROBGJIIQ-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1,1,1-trifluoro-5-(4-methylphenyl)pentane-2,4-dione |
| InChIKey | FOTCJBROBGJIIQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)