CAS 340825-17-4 is the registry number for 1(2H)-Naphthalenone, 3,4-dihydro-6-(2,2,2-trifluoroethoxy)-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-(2,2,2-trifluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one (CAS 340825-17-4) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 6-(2,2,2-trifluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: ZLGTUGZEPJTGBM-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | ZLGTUGZEPJTGBM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC(F)(F)F)C(=O)C1 |
Computed by PubChem (NCBI)