Products 2229373-07-1
CAS 2229373-07-1 is the registry number for 2-{1-[2-(trifluoromethyl)phenyl]cyclopropyl}acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
2-[1-[2-(trifluoromethyl)phenyl]cyclopropyl]acetic acid (CAS 2229373-07-1) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 2-[1-[2-(trifluoromethyl)phenyl]cyclopropyl]acetic acid. InChIKey: QLNYCXNPNSUVGG-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 2-[1-[2-(trifluoromethyl)phenyl]cyclopropyl]acetic acid |
| InChIKey | QLNYCXNPNSUVGG-UHFFFAOYSA-N |
| SMILES | C1CC1(CC(=O)O)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)