CAS 29765-48-8 appears in our catalog under these names: 1-([4-(Trifluoromethyl)phenyl]methyl)cyclopropane-1-carboxylic acid, 95%, 1-{(4-(trifluoromethyl)phenyl)methyl}cyclopropane-1-carboxylic acid, 95%, 1-{(4-(Trifluoromethyl)phenyl)methyl}cyclopropane-1-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 0,5g, 50mg.
1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropane-1-carboxylic acid (CAS 29765-48-8) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropane-1-carboxylic acid. InChIKey: IVZCJCNCVMKKLC-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropane-1-carboxylic acid |
| InChIKey | IVZCJCNCVMKKLC-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=C(C=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)