CAS 94856-20-9 is the registry number for 1-(2,4-Dimethylphenyl)-4,4,4-trifluoro-1,3-butanedione. Offered by: TRC. Available pack sizes: 500mg.
1-(2,4-dimethylphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 94856-20-9) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: DSEGNKJPZXXYBD-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-(2,4-dimethylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | DSEGNKJPZXXYBD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)CC(=O)C(F)(F)F)C |
Computed by PubChem (NCBI)