CAS 1495-03-0 is the registry number for 1-(4-Ethylphenyl)-4,4,4-trifluorobutane-1,3-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
1-(4-ethylphenyl)-4,4,4-trifluorobutane-1,3-dione (CAS 1495-03-0) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1-(4-ethylphenyl)-4,4,4-trifluorobutane-1,3-dione. InChIKey: KDDQMNMAUZHOMD-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| InChIKey | KDDQMNMAUZHOMD-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)