Products 1889796-55-7
CAS 1889796-55-7 appears in our catalog under these names: 1-(4-Trifluoromethyl-phenyl)-cyclopropanecarboxylic acid methyl ester, 95%, Methyl 1-(4-(trifluoromethyl)phenyl)cyclopropane-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate (CAS 1889796-55-7) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: methyl 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate. InChIKey: BYRJROCWZNKLTO-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | methyl 1-[4-(trifluoromethyl)phenyl]cyclopropane-1-carboxylate |
| InChIKey | BYRJROCWZNKLTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)