Products 2901949-99-1
CAS 2901949-99-1 is the registry number for 7-(Trifluoromethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (CAS 2901949-99-1) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid. InChIKey: AKAZAHDKHRNHDV-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 7-(trifluoromethyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | AKAZAHDKHRNHDV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)