CAS 151157-58-3 appears in our catalog under these names: 1–(3–(trifluoromethyl)phenyl)cyclobutane–1–carboxylic acid, 1-(3-(Trifluoromethyl)phenyl)cyclobutane-1-carboxylic acid, 1-(3-(Trifluoromethyl)phenyl)cyclobutanecarboxylic acid, 98%, 98%, 1-[3-(Trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg.
1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid (CAS 151157-58-3) is a chemical compound with the molecular formula C12H11F3O2 and a molecular weight of 244.21 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid. InChIKey: OEIXASDDYLPZFJ-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O2 |
|---|---|
| Molecular weight | 244.21 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]cyclobutane-1-carboxylic acid |
| InChIKey | OEIXASDDYLPZFJ-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)