CAS 130111-80-7 appears in our catalog under these names: 3,4-Dichlorocinnoline, 95%, 95%, 3,4-Dichlorocinnoline, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3,4-dichlorocinnoline (CAS 130111-80-7) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 3,4-dichlorocinnoline. InChIKey: TUZOGAXBRCITFU-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 3,4-dichlorocinnoline |
| InChIKey | TUZOGAXBRCITFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N=N2)Cl)Cl |
Computed by PubChem (NCBI)