CAS 1306604-95-4 appears in our catalog under these names: 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride, 95%, 1-(Furan-2-yl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
1-(furan-2-yl)-2-piperazin-1-ylethanone;dihydrochloride (CAS 1306604-95-4) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: 1-(furan-2-yl)-2-piperazin-1-ylethanone;dihydrochloride. InChIKey: UEVMPQYIGOSDKD-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 1-(furan-2-yl)-2-piperazin-1-ylethanone;dihydrochloride |
| InChIKey | UEVMPQYIGOSDKD-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC(=O)C2=CC=CO2.Cl.Cl |
Computed by PubChem (NCBI)