CAS 2109874-03-3 is the registry number for (S)-Ethyl 3-amino-3-(pyridin-2-yl)propanoate dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl (3S)-3-amino-3-pyridin-2-ylpropanoate;dihydrochloride (CAS 2109874-03-3) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: ethyl (3S)-3-amino-3-pyridin-2-ylpropanoate;dihydrochloride. InChIKey: DJUVQZOUXBYIQA-JZGIKJSDSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-pyridin-2-ylpropanoate;dihydrochloride |
| InChIKey | DJUVQZOUXBYIQA-JZGIKJSDSA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)