CAS 1808338-51-3 is the registry number for (2R,3S)-2-(6-Methoxypyridin-3-yl)tetrahydrofuran-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2-(6-methoxy-3-pyridinyl)oxolan-3-amine;dihydrochloride (CAS 1808338-51-3) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: (2R,3S)-2-(6-methoxy-3-pyridinyl)oxolan-3-amine;dihydrochloride. InChIKey: BKOIPTKTVCDCNV-UQZKZZBYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | (2R,3S)-2-(6-methoxy-3-pyridinyl)oxolan-3-amine;dihydrochloride |
| InChIKey | BKOIPTKTVCDCNV-UQZKZZBYSA-N |
| SMILES | COC1=NC=C(C=C1)[C@@H]2[C@H](CCO2)N.Cl.Cl |
Computed by PubChem (NCBI)