CAS 153524-69-7 appears in our catalog under these names: Ethyl (s)-3-(3-pyridyl)-beta-alanate dihydrochloride, 95%, (S)-Ethyl 3-amino-3-(pyridin-3-yl)propanoate dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Ethyl (3S)-3-amino-3-pyridin-3-ylpropanoate;dihydrochloride (CAS 153524-69-7) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: ethyl (3S)-3-amino-3-pyridin-3-ylpropanoate;dihydrochloride. InChIKey: GGANVLPLTUQZIF-WWPIYYJJSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | ethyl (3S)-3-amino-3-pyridin-3-ylpropanoate;dihydrochloride |
| InChIKey | GGANVLPLTUQZIF-WWPIYYJJSA-N |
| SMILES | CCOC(=O)C[C@@H](C1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)