CAS 150576-46-8 is the registry number for (+/-)-trans-1,2-Bis(chloroacetamido)cyclohexane. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2-chloro-N-[(1S,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]acetamide (CAS 150576-46-8) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: 2-chloro-N-[(1S,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]acetamide. InChIKey: NXWRKAARNQHEEG-YUMQZZPRSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 2-chloro-N-[(1S,2S)-2-[(2-chloroacetyl)amino]cyclohexyl]acetamide |
| InChIKey | NXWRKAARNQHEEG-YUMQZZPRSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)NC(=O)CCl)NC(=O)CCl |
Computed by PubChem (NCBI)