CAS 33560-87-1 appears in our catalog under these names: 2-Amino-3-pyridin-2-yl-propionic acid ethyl ester dihydrochloride, 95%, Ethyl 2–amino–3–(pyridin–2–yl)propanoate dihydrochloride, Ethyl 2-amino-3-(pyridin-2-yl)propanoate dihydrochloride, Ethyl 2-amino-3-(pyridin-2-yl)propanoate dihydrochloride, 98%, 98%, ETHYL 2-AMINO-3-(PYRIDIN-2-YL)PROPANOATE 2HCL, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 2,5g.
Ethyl 2-amino-3-pyridin-2-ylpropanoate;dihydrochloride (CAS 33560-87-1) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: ethyl 2-amino-3-pyridin-2-ylpropanoate;dihydrochloride. InChIKey: LGQBRRAWFWTBDN-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | ethyl 2-amino-3-pyridin-2-ylpropanoate;dihydrochloride |
| InChIKey | LGQBRRAWFWTBDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=CC=N1)N.Cl.Cl |
Computed by PubChem (NCBI)