CAS 1427380-97-9 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethane-1,2-diamine dihydrochloride, 95%, 1-(2,3-Dihydro-1,4-benzodioxin-6-yl)ethane-1,2-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethane-1,2-diamine;dihydrochloride (CAS 1427380-97-9) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethane-1,2-diamine;dihydrochloride. InChIKey: BRPGOCXUFXVSTG-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethane-1,2-diamine;dihydrochloride |
| InChIKey | BRPGOCXUFXVSTG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(CN)N.Cl.Cl |
Computed by PubChem (NCBI)