CAS 63999-89-3 appears in our catalog under these names: 2-Ao-3-(3-(aomethyl)phenyl)propanoic acid dihydrochloride, 2-Amino-3-[3-(aminomethyl)phenyl]propanoic acid dihydrochloride, 95%, 2-Amino-3-(3-(aminomethyl)phenyl)propanoic acid dihydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
2-amino-3-[3-(aminomethyl)phenyl]propanoic acid;dihydrochloride (CAS 63999-89-3) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: 2-amino-3-[3-(aminomethyl)phenyl]propanoic acid;dihydrochloride. InChIKey: VNUZIJWSJILKRV-UHFFFAOYSA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 2-amino-3-[3-(aminomethyl)phenyl]propanoic acid;dihydrochloride |
| InChIKey | VNUZIJWSJILKRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)CN)CC(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)