CAS 240429-07-6 appears in our catalog under these names: (R)-Methyl 2-amino-3-(4-aminophenyl)propanoate dihydrochloride, 95%, (R)–Methyl 2–amino–3–(4–aminophenyl)propanoate dihydrochloride, (R)-Methyl 2-amino-3-(4-aminophenyl)propanoate dihydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
Methyl (2R)-2-amino-3-(4-aminophenyl)propanoate;dihydrochloride (CAS 240429-07-6) is a chemical compound with the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.15 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-aminophenyl)propanoate;dihydrochloride. InChIKey: PKMKAKAMQCZLDK-KLQYNRQASA-N.
| Molecular formula | C10H16Cl2N2O2 |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-aminophenyl)propanoate;dihydrochloride |
| InChIKey | PKMKAKAMQCZLDK-KLQYNRQASA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)