Products 1308647-48-4
CAS 1308647-48-4 is the registry number for 1-(1-(4-Bromophenyl)-1-oxopropan-2-yl)pyrrolidine-2,5-dione. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[1-(4-bromophenyl)-1-oxopropan-2-yl]pyrrolidine-2,5-dione (CAS 1308647-48-4) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 1-[1-(4-bromophenyl)-1-oxopropan-2-yl]pyrrolidine-2,5-dione. InChIKey: YBWPSFGRBHJMPD-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 1-[1-(4-bromophenyl)-1-oxopropan-2-yl]pyrrolidine-2,5-dione |
| InChIKey | YBWPSFGRBHJMPD-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Br)N2C(=O)CCC2=O |
Computed by PubChem (NCBI)