CAS 1311314-99-4 appears in our catalog under these names: 2–(2,3–Dichlorophenyl)cyclopropan–1–amine hydrochloride, 2-(2,3-Dichlorophenyl)cyclopropan-1-amine hydrochloride 95%, 2-(2,3-Dichlorophenyl)cyclopropan-1-amine hydrochloride, 95%, 95%, 2-(2,3-Dichlorophenyl)cyclopropan-1-amine hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(2,3-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1311314-99-4) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: OVCXBYZZPOUHKM-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | OVCXBYZZPOUHKM-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=C(C(=CC=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)