CAS 1807901-49-0 is the registry number for rel-(1R,2S)-2-(2,4-Dichlorophenyl)cyclopropanamine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Trans-(1R,2S)-2-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 1807901-49-0) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: trans-(1R,2S)-2-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: VBYWXDXPQBZRIB-DKXTVVGFSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | trans-(1R,2S)-2-(2,4-dichlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | VBYWXDXPQBZRIB-DKXTVVGFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)